C19H25N7O4 — CID 123969997
2-[[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)diazenyl]methyl]-4-methoxyphenol (PubChem CID 123969997) has the molecular formula C19H25N7O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-[[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)diazenyl]methyl]-4-methoxyphenol.
| Compound Name | 2-[[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)diazenyl]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 123969997 |
| Molecular Formula | C19H25N7O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-[[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)diazenyl]methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C/N=N/c2nc(N3CCOCC3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C19H25N7O4/c1-28-15-2-3-16(27)14(12-15)13-20-24-17-21-18(25-4-8-29-9-5-25)23-19(22-17)26-6-10-30-11-7-26/h2-3,12,27H,4-11,13H2,1H3/b24-20+ |
| InChIKey | DVCRWYAVMVJVDT-HIXSDJFHSA-N |
| XLogP | 1.54 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|