C20H25I2N7O — CID 170922136
2-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]diazenyl]methyl]-4,6-diiodophenol (PubChem CID 170922136) has the molecular formula C20H25I2N7O and a molecular weight of 633.28 g/mol. Its IUPAC name is 2-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]diazenyl]methyl]-4,6-diiodophenol.
| Compound Name | 2-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]diazenyl]methyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 170922136 |
| Molecular Formula | C20H25I2N7O |
| Molecular Weight | 633.28 g/mol |
| Exact Mass | 633.02 |
| IUPAC Name | 2-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]diazenyl]methyl]-4,6-diiodophenol |
| SMILES | Oc1c(I)cc(I)cc1C/N=N/c1nc(N2CCCCC2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C20H25I2N7O/c21-15-11-14(17(30)16(22)12-15)13-23-27-18-24-19(28-7-3-1-4-8-28)26-20(25-18)29-9-5-2-6-10-29/h11-12,30H,1-10,13H2/b27-23+ |
| InChIKey | CPPKFHDFXUTALW-SLEBQGDGSA-N |
| XLogP | 5.05 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.28 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|