C16H16BrClFN5O — CID 91030843
4-bromo-2-chloro-6-[[(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)diazenyl]methyl]phenol (PubChem CID 91030843) has the molecular formula C16H16BrClFN5O and a molecular weight of 428.69 g/mol. Its IUPAC name is 4-bromo-2-chloro-6-[[(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)diazenyl]methyl]phenol.
| Compound Name | 4-bromo-2-chloro-6-[[(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)diazenyl]methyl]phenol |
|---|---|
| PubChem CID | 91030843 |
| Molecular Formula | C16H16BrClFN5O |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 4-bromo-2-chloro-6-[[(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)diazenyl]methyl]phenol |
| SMILES | Oc1c(Cl)cc(Br)cc1C/N=N/c1ncc(F)c(N2CCCCC2)n1 |
| InChI | InChI=1S/C16H16BrClFN5O/c17-11-6-10(14(25)12(18)7-11)8-21-23-16-20-9-13(19)15(22-16)24-4-2-1-3-5-24/h6-7,9,25H,1-5,8H2/b23-21+ |
| InChIKey | SLRWUNUHPYNPLO-XTQSDGFTSA-N |
| XLogP | 5.01 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|