C15H22I2N2O — CID 119041326
2,4-diiodo-6-[(3-piperidin-1-ylpropylamino)methyl]phenol (PubChem CID 119041326) has the molecular formula C15H22I2N2O and a molecular weight of 500.16 g/mol. Its IUPAC name is 2,4-diiodo-6-[(3-piperidin-1-ylpropylamino)methyl]phenol.
| Compound Name | 2,4-diiodo-6-[(3-piperidin-1-ylpropylamino)methyl]phenol |
|---|---|
| PubChem CID | 119041326 |
| Molecular Formula | C15H22I2N2O |
| Molecular Weight | 500.16 g/mol |
| Exact Mass | 499.98 |
| IUPAC Name | 2,4-diiodo-6-[(3-piperidin-1-ylpropylamino)methyl]phenol |
| SMILES | Oc1c(I)cc(I)cc1CNCCCN1CCCCC1 |
| InChI | InChI=1S/C15H22I2N2O/c16-13-9-12(15(20)14(17)10-13)11-18-5-4-8-19-6-2-1-3-7-19/h9-10,18,20H,1-8,11H2 |
| InChIKey | VBDXQNORQSTNKZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.16 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|