C16H23I2N3O2 — CID 123276398
1-[3-[(2-hydroxy-3,5-diiodophenyl)methylamino]propyl]piperidine-3-carboxamide (PubChem CID 123276398) has the molecular formula C16H23I2N3O2 and a molecular weight of 543.19 g/mol. Its IUPAC name is 1-[3-[(2-hydroxy-3,5-diiodophenyl)methylamino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[(2-hydroxy-3,5-diiodophenyl)methylamino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 123276398 |
| Molecular Formula | C16H23I2N3O2 |
| Molecular Weight | 543.19 g/mol |
| Exact Mass | 542.99 |
| IUPAC Name | 1-[3-[(2-hydroxy-3,5-diiodophenyl)methylamino]propyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(CCCNCc2cc(I)cc(I)c2O)C1 |
| InChI | InChI=1S/C16H23I2N3O2/c17-13-7-12(15(22)14(18)8-13)9-20-4-2-6-21-5-1-3-11(10-21)16(19)23/h7-8,11,20,22H,1-6,9-10H2,(H2,19,23) |
| InChIKey | NITGIHMMBADJGO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|