C16H25I2N3O — CID 119041348
2-[[3-(4-ethylpiperazin-1-yl)propylamino]methyl]-4,6-diiodophenol (PubChem CID 119041348) has the molecular formula C16H25I2N3O and a molecular weight of 529.20 g/mol. Its IUPAC name is 2-[[3-(4-ethylpiperazin-1-yl)propylamino]methyl]-4,6-diiodophenol.
| Compound Name | 2-[[3-(4-ethylpiperazin-1-yl)propylamino]methyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 119041348 |
| Molecular Formula | C16H25I2N3O |
| Molecular Weight | 529.20 g/mol |
| Exact Mass | 529.01 |
| IUPAC Name | 2-[[3-(4-ethylpiperazin-1-yl)propylamino]methyl]-4,6-diiodophenol |
| SMILES | CCN1CCN(CCCNCc2cc(I)cc(I)c2O)CC1 |
| InChI | InChI=1S/C16H25I2N3O/c1-2-20-6-8-21(9-7-20)5-3-4-19-12-13-10-14(17)11-15(18)16(13)22/h10-11,19,22H,2-9,12H2,1H3 |
| InChIKey | XUWXEWPRZSEVAU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|