C15H23I2N3O — CID 71144947
2,4-diiodo-6-[[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]methyl]phenol (PubChem CID 71144947) has the molecular formula C15H23I2N3O and a molecular weight of 515.18 g/mol. Its IUPAC name is 2,4-diiodo-6-[[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]methyl]phenol.
| Compound Name | 2,4-diiodo-6-[[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 71144947 |
| Molecular Formula | C15H23I2N3O |
| Molecular Weight | 515.18 g/mol |
| Exact Mass | 514.99 |
| IUPAC Name | 2,4-diiodo-6-[[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]methyl]phenol |
| SMILES | CN1CCN(CCN(C)Cc2cc(I)cc(I)c2O)CC1 |
| InChI | InChI=1S/C15H23I2N3O/c1-18-3-6-20(7-4-18)8-5-19(2)11-12-9-13(16)10-14(17)15(12)21/h9-10,21H,3-8,11H2,1-2H3 |
| InChIKey | IQPDCXXVHAHFFO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|