C17H27I2N3O — CID 71144813
2-[[4-[2-(dimethylamino)ethyl-methylamino]piperidin-1-yl]methyl]-4,6-diiodophenol (PubChem CID 71144813) has the molecular formula C17H27I2N3O and a molecular weight of 543.23 g/mol. Its IUPAC name is 2-[[4-[2-(dimethylamino)ethyl-methylamino]piperidin-1-yl]methyl]-4,6-diiodophenol.
| Compound Name | 2-[[4-[2-(dimethylamino)ethyl-methylamino]piperidin-1-yl]methyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 71144813 |
| Molecular Formula | C17H27I2N3O |
| Molecular Weight | 543.23 g/mol |
| Exact Mass | 543.02 |
| IUPAC Name | 2-[[4-[2-(dimethylamino)ethyl-methylamino]piperidin-1-yl]methyl]-4,6-diiodophenol |
| SMILES | CN(C)CCN(C)C1CCN(Cc2cc(I)cc(I)c2O)CC1 |
| InChI | InChI=1S/C17H27I2N3O/c1-20(2)8-9-21(3)15-4-6-22(7-5-15)12-13-10-14(18)11-16(19)17(13)23/h10-11,15,23H,4-9,12H2,1-3H3 |
| InChIKey | AUFJSQOHZXKMJL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|