C15H25N3O — CID 28656653
2-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenol (PubChem CID 28656653) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenol.
| Compound Name | 2-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenol |
|---|---|
| PubChem CID | 28656653 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 2-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenol |
| SMILES | CN1CCN(CCCNCc2ccccc2O)CC1 |
| InChI | InChI=1S/C15H25N3O/c1-17-9-11-18(12-10-17)8-4-7-16-13-14-5-2-3-6-15(14)19/h2-3,5-6,16,19H,4,7-13H2,1H3 |
| InChIKey | LIUMXZPNZPEQRR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|