C21H34N4O2 — CID 119109310
2-[2-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 119109310) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-[2-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[2-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 119109310 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 2-[2-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | CN1CCN(CCCNCc2ccccc2OCC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C21H34N4O2/c1-23-13-15-24(16-14-23)10-6-9-22-17-19-7-2-3-8-20(19)27-18-21(26)25-11-4-5-12-25/h2-3,7-8,22H,4-6,9-18H2,1H3 |
| InChIKey | LNTQKKXLIKPGCH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|