C27H27N7O2 — CID 170922711
4-morpholin-4-yl-N-phenyl-6-[(2-phenylmethoxyphenyl)methyldiazenyl]-1,3,5-triazin-2-amine (PubChem CID 170922711) has the molecular formula C27H27N7O2 and a molecular weight of 481.56 g/mol. Its IUPAC name is 4-morpholin-4-yl-N-phenyl-6-[(2-phenylmethoxyphenyl)methyldiazenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-morpholin-4-yl-N-phenyl-6-[(2-phenylmethoxyphenyl)methyldiazenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 170922711 |
| Molecular Formula | C27H27N7O2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 4-morpholin-4-yl-N-phenyl-6-[(2-phenylmethoxyphenyl)methyldiazenyl]-1,3,5-triazin-2-amine |
| SMILES | c1ccc(COc2ccccc2C/N=N/c2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C27H27N7O2/c1-3-9-21(10-4-1)20-36-24-14-8-7-11-22(24)19-28-33-26-30-25(29-23-12-5-2-6-13-23)31-27(32-26)34-15-17-35-18-16-34/h1-14H,15-20H2,(H,29,30,31,32)/b33-28+ |
| InChIKey | JGJMKSXYKZEDNZ-PJJLUWSFSA-N |
| XLogP | 5.31 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|