C21H20N8O5 — CID 123399322
4-morpholin-4-yl-6-[(6-nitro-1,3-benzodioxol-5-yl)methyldiazenyl]-N-phenyl-1,3,5-triazin-2-amine (PubChem CID 123399322) has the molecular formula C21H20N8O5 and a molecular weight of 464.44 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-[(6-nitro-1,3-benzodioxol-5-yl)methyldiazenyl]-N-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-morpholin-4-yl-6-[(6-nitro-1,3-benzodioxol-5-yl)methyldiazenyl]-N-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123399322 |
| Molecular Formula | C21H20N8O5 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 4-morpholin-4-yl-6-[(6-nitro-1,3-benzodioxol-5-yl)methyldiazenyl]-N-phenyl-1,3,5-triazin-2-amine |
| SMILES | O=[N+]([O-])c1cc2c(cc1C/N=N/c1nc(Nc3ccccc3)nc(N3CCOCC3)n1)OCO2 |
| InChI | InChI=1S/C21H20N8O5/c30-29(31)16-11-18-17(33-13-34-18)10-14(16)12-22-27-20-24-19(23-15-4-2-1-3-5-15)25-21(26-20)28-6-8-32-9-7-28/h1-5,10-11H,6-9,12-13H2,(H,23,24,25,26)/b27-22+ |
| InChIKey | ICBRSMTYKLFCOD-HPNDGRJYSA-N |
| XLogP | 3.37 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|