C22H25N9O4 — CID 91501256
(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-[[1-(4-nitrophenyl)pyrrol-2-yl]methyl]diazene (PubChem CID 91501256) has the molecular formula C22H25N9O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-[[1-(4-nitrophenyl)pyrrol-2-yl]methyl]diazene.
| Compound Name | (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-[[1-(4-nitrophenyl)pyrrol-2-yl]methyl]diazene |
|---|---|
| PubChem CID | 91501256 |
| Molecular Formula | C22H25N9O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-[[1-(4-nitrophenyl)pyrrol-2-yl]methyl]diazene |
| SMILES | O=[N+]([O-])c1ccc(-n2cccc2C/N=N/c2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C22H25N9O4/c32-31(33)18-5-3-17(4-6-18)30-7-1-2-19(30)16-23-27-20-24-21(28-8-12-34-13-9-28)26-22(25-20)29-10-14-35-15-11-29/h1-7H,8-16H2/b27-23+ |
| InChIKey | XQTLHLAPCQDQOG-SLEBQGDGSA-N |
| XLogP | 2.53 |
| TPSA | 136.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|