C22H22N8O3 — CID 170921654
4-morpholin-4-yl-N-(4-nitrophenyl)-6-(3-phenylprop-1-enyldiazenyl)-1,3,5-triazin-2-amine (PubChem CID 170921654) has the molecular formula C22H22N8O3 and a molecular weight of 446.47 g/mol. Its IUPAC name is 4-morpholin-4-yl-N-(4-nitrophenyl)-6-(3-phenylprop-1-enyldiazenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-morpholin-4-yl-N-(4-nitrophenyl)-6-(3-phenylprop-1-enyldiazenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 170921654 |
| Molecular Formula | C22H22N8O3 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 4-morpholin-4-yl-N-(4-nitrophenyl)-6-(3-phenylprop-1-enyldiazenyl)-1,3,5-triazin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(/N=N/C=CCc3ccccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C22H22N8O3/c31-30(32)19-10-8-18(9-11-19)24-20-25-21(27-22(26-20)29-13-15-33-16-14-29)28-23-12-4-7-17-5-2-1-3-6-17/h1-6,8-12H,7,13-16H2,(H,24,25,26,27)/b12-4?,28-23+ |
| InChIKey | KYKPMVXJIUJCAR-DRUWVJMBSA-N |
| XLogP | 4.20 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|