C34H42N14O8 — CID 129216917
4,6-dimorpholin-4-yl-N-(4-nitrophenyl)-1,3,5-triazin-2-amine (PubChem CID 129216917) has the molecular formula C34H42N14O8 and a molecular weight of 774.80 g/mol. Its IUPAC name is 4,6-dimorpholin-4-yl-N-(4-nitrophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimorpholin-4-yl-N-(4-nitrophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 129216917 |
| Molecular Formula | C34H42N14O8 |
| Molecular Weight | 774.80 g/mol |
| Exact Mass | 774.33 |
| IUPAC Name | 4,6-dimorpholin-4-yl-N-(4-nitrophenyl)-1,3,5-triazin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1.O=[N+]([O-])c1ccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/2C17H21N7O4/c2*25-24(26)14-3-1-13(2-4-14)18-15-19-16(22-5-9-27-10-6-22)21-17(20-15)23-7-11-28-12-8-23/h2*1-4H,5-12H2,(H,18,19,20,21) |
| InChIKey | KLHPPXBJZZXQMD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 237.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.80 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|