C25H31N9O — CID 123946294
4-[[4-(4-methylpiperazin-1-yl)phenyl]methyldiazenyl]-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine (PubChem CID 123946294) has the molecular formula C25H31N9O and a molecular weight of 473.59 g/mol. Its IUPAC name is 4-[[4-(4-methylpiperazin-1-yl)phenyl]methyldiazenyl]-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[[4-(4-methylpiperazin-1-yl)phenyl]methyldiazenyl]-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123946294 |
| Molecular Formula | C25H31N9O |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 4-[[4-(4-methylpiperazin-1-yl)phenyl]methyldiazenyl]-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine |
| SMILES | CN1CCN(c2ccc(C/N=N/c3nc(Nc4ccccc4)nc(N4CCOCC4)n3)cc2)CC1 |
| InChI | InChI=1S/C25H31N9O/c1-32-11-13-33(14-12-32)22-9-7-20(8-10-22)19-26-31-24-28-23(27-21-5-3-2-4-6-21)29-25(30-24)34-15-17-35-18-16-34/h2-10H,11-19H2,1H3,(H,27,28,29,30)/b31-26+ |
| InChIKey | YTHDSDRDTQPYGS-GKPLWNPISA-N |
| XLogP | 3.49 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|