C23H22F5N7O2 — CID 123356804
4-[[4-(2,2-difluoroethyl)phenyl]methyldiazenyl]-6-morpholin-4-yl-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine (PubChem CID 123356804) has the molecular formula C23H22F5N7O2 and a molecular weight of 523.47 g/mol. Its IUPAC name is 4-[[4-(2,2-difluoroethyl)phenyl]methyldiazenyl]-6-morpholin-4-yl-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-[[4-(2,2-difluoroethyl)phenyl]methyldiazenyl]-6-morpholin-4-yl-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123356804 |
| Molecular Formula | C23H22F5N7O2 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 4-[[4-(2,2-difluoroethyl)phenyl]methyldiazenyl]-6-morpholin-4-yl-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
| SMILES | FC(F)Cc1ccc(C/N=N/c2nc(Nc3ccc(OC(F)(F)F)cc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C23H22F5N7O2/c24-19(25)13-15-1-3-16(4-2-15)14-29-34-21-31-20(32-22(33-21)35-9-11-36-12-10-35)30-17-5-7-18(8-6-17)37-23(26,27)28/h1-8,19H,9-14H2,(H,30,31,32,33)/b34-29+ |
| InChIKey | RRMBMXHWNGEXBD-RIHQVDFKSA-N |
| XLogP | 5.44 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|