C22H19Cl2F4N7O2 — CID 90864311
4-[(3,4-dichlorophenyl)methyldiazenyl]-6-morpholin-4-yl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine (PubChem CID 90864311) has the molecular formula C22H19Cl2F4N7O2 and a molecular weight of 560.34 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyldiazenyl]-6-morpholin-4-yl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-[(3,4-dichlorophenyl)methyldiazenyl]-6-morpholin-4-yl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 90864311 |
| Molecular Formula | C22H19Cl2F4N7O2 |
| Molecular Weight | 560.34 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyldiazenyl]-6-morpholin-4-yl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine |
| SMILES | FC(F)C(F)(F)Oc1ccc(Nc2nc(/N=N/Cc3ccc(Cl)c(Cl)c3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C22H19Cl2F4N7O2/c23-16-6-1-13(11-17(16)24)12-29-34-20-31-19(32-21(33-20)35-7-9-36-10-8-35)30-14-2-4-15(5-3-14)37-22(27,28)18(25)26/h1-6,11,18H,7-10,12H2,(H,30,31,32,33)/b34-29+ |
| InChIKey | ZFSXEXSIESTHRS-RIHQVDFKSA-N |
| XLogP | 6.28 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.34 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|