C16H15ClF2N2O3 — CID 1353718
4-[5-chloro-3,6-difluoro-4-(4-methoxyphenoxy)-2-pyridinyl]morpholine (PubChem CID 1353718) has the molecular formula C16H15ClF2N2O3 and a molecular weight of 356.76 g/mol. Its IUPAC name is 4-[5-chloro-3,6-difluoro-4-(4-methoxyphenoxy)-2-pyridinyl]morpholine.
| Compound Name | 4-[5-chloro-3,6-difluoro-4-(4-methoxyphenoxy)-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 1353718 |
| Molecular Formula | C16H15ClF2N2O3 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4-[5-chloro-3,6-difluoro-4-(4-methoxyphenoxy)-2-pyridinyl]morpholine |
| SMILES | COc1ccc(Oc2c(F)c(N3CCOCC3)nc(F)c2Cl)cc1 |
| InChI | InChI=1S/C16H15ClF2N2O3/c1-22-10-2-4-11(5-3-10)24-14-12(17)15(19)20-16(13(14)18)21-6-8-23-9-7-21/h2-5H,6-9H2,1H3 |
| InChIKey | ANYCTUZMCGINEG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|