C22H19ClF4N6O3 — CID 58876934
3-chloro-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-2-hydroxy-5-[3-(trifluoromethyl)anilino]benzohydrazide (PubChem CID 58876934) has the molecular formula C22H19ClF4N6O3 and a molecular weight of 526.88 g/mol. Its IUPAC name is 3-chloro-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-2-hydroxy-5-[3-(trifluoromethyl)anilino]benzohydrazide.
| Compound Name | 3-chloro-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-2-hydroxy-5-[3-(trifluoromethyl)anilino]benzohydrazide |
|---|---|
| PubChem CID | 58876934 |
| Molecular Formula | C22H19ClF4N6O3 |
| Molecular Weight | 526.88 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | 3-chloro-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-2-hydroxy-5-[3-(trifluoromethyl)anilino]benzohydrazide |
| SMILES | O=C(NNc1ncc(F)c(N2CCOCC2)n1)c1cc(Nc2cccc(C(F)(F)F)c2)cc(Cl)c1O |
| InChI | InChI=1S/C22H19ClF4N6O3/c23-16-10-14(29-13-3-1-2-12(8-13)22(25,26)27)9-15(18(16)34)20(35)31-32-21-28-11-17(24)19(30-21)33-4-6-36-7-5-33/h1-3,8-11,29,34H,4-7H2,(H,31,35)(H,28,30,32) |
| InChIKey | CFODKTALBSLPJQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.88 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|