C27H26ClFN8O3 — CID 170125496
5-[3-chloro-5-[(3-hydroxyanilino)methyl]anilino]-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)pyridine-2-carbohydrazide (PubChem CID 170125496) has the molecular formula C27H26ClFN8O3 and a molecular weight of 565.01 g/mol. Its IUPAC name is 5-[3-chloro-5-[(3-hydroxyanilino)methyl]anilino]-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)pyridine-2-carbohydrazide.
| Compound Name | 5-[3-chloro-5-[(3-hydroxyanilino)methyl]anilino]-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 170125496 |
| Molecular Formula | C27H26ClFN8O3 |
| Molecular Weight | 565.01 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 5-[3-chloro-5-[(3-hydroxyanilino)methyl]anilino]-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)pyridine-2-carbohydrazide |
| SMILES | O=C(NNc1ncc(F)c(N2CCOCC2)n1)c1ccc(Nc2cc(Cl)cc(CNc3cccc(O)c3)c2)cn1 |
| InChI | InChI=1S/C27H26ClFN8O3/c28-18-10-17(14-30-19-2-1-3-22(38)13-19)11-21(12-18)33-20-4-5-24(31-15-20)26(39)35-36-27-32-16-23(29)25(34-27)37-6-8-40-9-7-37/h1-5,10-13,15-16,30,33,38H,6-9,14H2,(H,35,39)(H,32,34,36) |
| InChIKey | NIAOFSODDMXALB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.01 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|