C23H27FN8O2 — CID 58877083
5-[4-[(dimethylamino)methyl]anilino]-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)pyridine-2-carbohydrazide (PubChem CID 58877083) has the molecular formula C23H27FN8O2 and a molecular weight of 466.52 g/mol. Its IUPAC name is 5-[4-[(dimethylamino)methyl]anilino]-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)pyridine-2-carbohydrazide.
| Compound Name | 5-[4-[(dimethylamino)methyl]anilino]-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 58877083 |
| Molecular Formula | C23H27FN8O2 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 5-[4-[(dimethylamino)methyl]anilino]-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)pyridine-2-carbohydrazide |
| SMILES | CN(C)Cc1ccc(Nc2ccc(C(=O)NNc3ncc(F)c(N4CCOCC4)n3)nc2)cc1 |
| InChI | InChI=1S/C23H27FN8O2/c1-31(2)15-16-3-5-17(6-4-16)27-18-7-8-20(25-13-18)22(33)29-30-23-26-14-19(24)21(28-23)32-9-11-34-12-10-32/h3-8,13-14,27H,9-12,15H2,1-2H3,(H,29,33)(H,26,28,30) |
| InChIKey | PDLNVOJOETUECL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|