C25H28FN7O3 — CID 149461350
N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-[3-methyl-5-(oxolan-2-yl)anilino]pyridine-2-carbohydrazide (PubChem CID 149461350) has the molecular formula C25H28FN7O3 and a molecular weight of 493.54 g/mol. Its IUPAC name is N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-[3-methyl-5-(oxolan-2-yl)anilino]pyridine-2-carbohydrazide.
| Compound Name | N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-[3-methyl-5-(oxolan-2-yl)anilino]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 149461350 |
| Molecular Formula | C25H28FN7O3 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-[3-methyl-5-(oxolan-2-yl)anilino]pyridine-2-carbohydrazide |
| SMILES | Cc1cc(Nc2ccc(C(=O)NNc3ncc(F)c(N4CCOCC4)n3)nc2)cc(C2CCCO2)c1 |
| InChI | InChI=1S/C25H28FN7O3/c1-16-11-17(22-3-2-8-36-22)13-19(12-16)29-18-4-5-21(27-14-18)24(34)31-32-25-28-15-20(26)23(30-25)33-6-9-35-10-7-33/h4-5,11-15,22,29H,2-3,6-10H2,1H3,(H,31,34)(H,28,30,32) |
| InChIKey | SFCBUVQFRXDSNW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|