C31H44FN7O2 — CID 143430991
ethane;ethylcyclohexane;N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-(4-methylanilino)pyridine-2-carbohydrazide (PubChem CID 143430991) has the molecular formula C31H44FN7O2 and a molecular weight of 565.74 g/mol. Its IUPAC name is ethane;ethylcyclohexane;N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-(4-methylanilino)pyridine-2-carbohydrazide.
| Compound Name | ethane;ethylcyclohexane;N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-(4-methylanilino)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 143430991 |
| Molecular Formula | C31H44FN7O2 |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.35 |
| IUPAC Name | ethane;ethylcyclohexane;N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-(4-methylanilino)pyridine-2-carbohydrazide |
| SMILES | CC.CCC1CCCCC1.Cc1ccc(Nc2ccc(C(=O)NNc3ncc(F)c(N4CCOCC4)n3)nc2)cc1 |
| InChI | InChI=1S/C21H22FN7O2.C8H16.C2H6/c1-14-2-4-15(5-3-14)25-16-6-7-18(23-12-16)20(30)27-28-21-24-13-17(22)19(26-21)29-8-10-31-11-9-29;1-2-8-6-4-3-5-7-8;1-2/h2-7,12-13,25H,8-11H2,1H3,(H,27,30)(H,24,26,28);8H,2-7H2,1H3;1-2H3 |
| InChIKey | ZFEVINJXFDRCKH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|