C26H33FN10O — CID 143470929
N'-(5-fluoro-4-piperazin-1-ylpyrimidin-2-yl)-5-[4-[(4-methylpiperazin-1-yl)methyl]anilino]pyridine-2-carbohydrazide (PubChem CID 143470929) has the molecular formula C26H33FN10O and a molecular weight of 520.62 g/mol. Its IUPAC name is N'-(5-fluoro-4-piperazin-1-ylpyrimidin-2-yl)-5-[4-[(4-methylpiperazin-1-yl)methyl]anilino]pyridine-2-carbohydrazide.
| Compound Name | N'-(5-fluoro-4-piperazin-1-ylpyrimidin-2-yl)-5-[4-[(4-methylpiperazin-1-yl)methyl]anilino]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 143470929 |
| Molecular Formula | C26H33FN10O |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | N'-(5-fluoro-4-piperazin-1-ylpyrimidin-2-yl)-5-[4-[(4-methylpiperazin-1-yl)methyl]anilino]pyridine-2-carbohydrazide |
| SMILES | CN1CCN(Cc2ccc(Nc3ccc(C(=O)NNc4ncc(F)c(N5CCNCC5)n4)nc3)cc2)CC1 |
| InChI | InChI=1S/C26H33FN10O/c1-35-12-14-36(15-13-35)18-19-2-4-20(5-3-19)31-21-6-7-23(29-16-21)25(38)33-34-26-30-17-22(27)24(32-26)37-10-8-28-9-11-37/h2-7,16-17,28,31H,8-15,18H2,1H3,(H,33,38)(H,30,32,34) |
| InChIKey | NUMHGRVONWNWEG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|