C26H33FN10 — CID 143471021
5-fluoro-N-[(E)-[4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-pyridinyl]methylideneamino]-4-piperazin-1-ylpyrimidin-2-amine (PubChem CID 143471021) has the molecular formula C26H33FN10 and a molecular weight of 504.62 g/mol. Its IUPAC name is 5-fluoro-N-[(E)-[4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-pyridinyl]methylideneamino]-4-piperazin-1-ylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[(E)-[4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-pyridinyl]methylideneamino]-4-piperazin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 143471021 |
| Molecular Formula | C26H33FN10 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 5-fluoro-N-[(E)-[4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-pyridinyl]methylideneamino]-4-piperazin-1-ylpyrimidin-2-amine |
| SMILES | CN1CCN(Cc2ccc(Nc3ccnc(/C=N/Nc4ncc(F)c(N5CCNCC5)n4)c3)cc2)CC1 |
| InChI | InChI=1S/C26H33FN10/c1-35-12-14-36(15-13-35)19-20-2-4-21(5-3-20)32-22-6-7-29-23(16-22)17-31-34-26-30-18-24(27)25(33-26)37-10-8-28-9-11-37/h2-7,16-18,28H,8-15,19H2,1H3,(H,29,32)(H,30,33,34)/b31-17+ |
| InChIKey | QYTIHMOVKBICET-KBVAKVRCSA-N |
| XLogP | 2.36 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|