C20H27ClN6 — CID 143471113
N-[2-chloro-6-methyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-[(E)-(methylhydrazinylidene)methyl]pyridin-4-amine (PubChem CID 143471113) has the molecular formula C20H27ClN6 and a molecular weight of 386.93 g/mol. Its IUPAC name is N-[2-chloro-6-methyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-[(E)-(methylhydrazinylidene)methyl]pyridin-4-amine.
| Compound Name | N-[2-chloro-6-methyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-[(E)-(methylhydrazinylidene)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 143471113 |
| Molecular Formula | C20H27ClN6 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[2-chloro-6-methyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-[(E)-(methylhydrazinylidene)methyl]pyridin-4-amine |
| SMILES | CN/N=C/c1cc(Nc2c(C)cc(CN3CCN(C)CC3)cc2Cl)ccn1 |
| InChI | InChI=1S/C20H27ClN6/c1-15-10-16(14-27-8-6-26(3)7-9-27)11-19(21)20(15)25-17-4-5-23-18(12-17)13-24-22-2/h4-5,10-13,22H,6-9,14H2,1-3H3,(H,23,25)/b24-13+ |
| InChIKey | FFIZQYQPXCGEMT-ZMOGYAJESA-N |
| XLogP | 3.09 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|