C20H25ClN4O2 — CID 170503222
ethyl 2-chloro-4-[[5-[(4-methylpiperazin-1-yl)methyl]-2-pyridinyl]amino]benzoate (PubChem CID 170503222) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[5-[(4-methylpiperazin-1-yl)methyl]-2-pyridinyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-4-[[5-[(4-methylpiperazin-1-yl)methyl]-2-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 170503222 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | ethyl 2-chloro-4-[[5-[(4-methylpiperazin-1-yl)methyl]-2-pyridinyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ccc(CN3CCN(C)CC3)cn2)cc1Cl |
| InChI | InChI=1S/C20H25ClN4O2/c1-3-27-20(26)17-6-5-16(12-18(17)21)23-19-7-4-15(13-22-19)14-25-10-8-24(2)9-11-25/h4-7,12-13H,3,8-11,14H2,1-2H3,(H,22,23) |
| InChIKey | WFHCEVRFWIZEIH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |