C28H32F4N8O — CID 121369591
5-fluoro-N-[(E)-[4-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]phenyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 121369591) has the molecular formula C28H32F4N8O and a molecular weight of 572.61 g/mol. Its IUPAC name is 5-fluoro-N-[(E)-[4-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]phenyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[(E)-[4-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]phenyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 121369591 |
| Molecular Formula | C28H32F4N8O |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 5-fluoro-N-[(E)-[4-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]phenyl]methylideneamino]-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | CN1CCN(Cc2ccc(Nc3ccc(/C=N/Nc4ncc(F)c(N5CCOCC5)n4)cc3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H32F4N8O/c1-38-8-10-39(11-9-38)19-21-4-7-23(16-24(21)28(30,31)32)35-22-5-2-20(3-6-22)17-34-37-27-33-18-25(29)26(36-27)40-12-14-41-15-13-40/h2-7,16-18,35H,8-15,19H2,1H3,(H,33,36,37)/b34-17+ |
| InChIKey | GQKHRIRGKMMQGW-KVAAJVFYSA-N |
| XLogP | 4.41 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|