C28H33ClFN7O2 — CID 157494767
2-chloro-6-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)methyliminomethyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol (PubChem CID 157494767) has the molecular formula C28H33ClFN7O2 and a molecular weight of 554.07 g/mol. Its IUPAC name is 2-chloro-6-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)methyliminomethyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol.
| Compound Name | 2-chloro-6-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)methyliminomethyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol |
|---|---|
| PubChem CID | 157494767 |
| Molecular Formula | C28H33ClFN7O2 |
| Molecular Weight | 554.07 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 2-chloro-6-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)methyliminomethyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol |
| SMILES | CN1CCN(Cc2ccc(Nc3cc(Cl)c(O)c(/C=N/Cc4ncc(F)c(N5CCOCC5)n4)c3)cc2)CC1 |
| InChI | InChI=1S/C28H33ClFN7O2/c1-35-6-8-36(9-7-35)19-20-2-4-22(5-3-20)33-23-14-21(27(38)24(29)15-23)16-31-18-26-32-17-25(30)28(34-26)37-10-12-39-13-11-37/h2-5,14-17,33,38H,6-13,18-19H2,1H3/b31-16+ |
| InChIKey | DGJCTLOGHVQMJO-WCMJOSRZSA-N |
| XLogP | 3.92 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.07 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|