C29H37ClFN8O2+ — CID 143431003
[(E)-[3-chloro-2-hydroxy-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]methylideneamino]-[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]azanium (PubChem CID 143431003) has the molecular formula C29H37ClFN8O2+ and a molecular weight of 584.12 g/mol. Its IUPAC name is [(E)-[3-chloro-2-hydroxy-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]methylideneamino]-[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]azanium.
| Compound Name | [(E)-[3-chloro-2-hydroxy-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]methylideneamino]-[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]azanium |
|---|---|
| PubChem CID | 143431003 |
| Molecular Formula | C29H37ClFN8O2+ |
| Molecular Weight | 584.12 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | [(E)-[3-chloro-2-hydroxy-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]methylideneamino]-[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]azanium |
| SMILES | CN1CCN(Cc2ccc(-c3cc(Cl)c(O)c(/C=N/[NH2+]c4ncc(F)c(N5CCN(CCO)CC5)n4)c3)cc2)CC1 |
| InChI | InChI=1S/C29H36ClFN8O2/c1-36-6-8-38(9-7-36)20-21-2-4-22(5-3-21)23-16-24(27(41)25(30)17-23)18-33-35-29-32-19-26(31)28(34-29)39-12-10-37(11-13-39)14-15-40/h2-5,16-19,40-41H,6-15,20H2,1H3,(H,32,34,35)/p+1/b33-18+ |
| InChIKey | PMWZOHIAAXOLNT-DPNNOFEESA-O |
| XLogP | 1.73 |
| TPSA | 108.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.12 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|