C23H22F4N6O — CID 58876751
5-fluoro-4-(3-methylmorpholin-4-yl)-N-[(E)-[4-[3-(trifluoromethyl)anilino]phenyl]methylideneamino]pyrimidin-2-amine (PubChem CID 58876751) has the molecular formula C23H22F4N6O and a molecular weight of 474.46 g/mol. Its IUPAC name is 5-fluoro-4-(3-methylmorpholin-4-yl)-N-[(E)-[4-[3-(trifluoromethyl)anilino]phenyl]methylideneamino]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-(3-methylmorpholin-4-yl)-N-[(E)-[4-[3-(trifluoromethyl)anilino]phenyl]methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58876751 |
| Molecular Formula | C23H22F4N6O |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 5-fluoro-4-(3-methylmorpholin-4-yl)-N-[(E)-[4-[3-(trifluoromethyl)anilino]phenyl]methylideneamino]pyrimidin-2-amine |
| SMILES | CC1COCCN1c1nc(N/N=C/c2ccc(Nc3cccc(C(F)(F)F)c3)cc2)ncc1F |
| InChI | InChI=1S/C23H22F4N6O/c1-15-14-34-10-9-33(15)21-20(24)13-28-22(31-21)32-29-12-16-5-7-18(8-6-16)30-19-4-2-3-17(11-19)23(25,26)27/h2-8,11-13,15,30H,9-10,14H2,1H3,(H,28,31,32)/b29-12+ |
| InChIKey | GATHFGPZHXNHCJ-XKJRVUDJSA-N |
| XLogP | 5.05 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|