C24H25F4N7O — CID 58877178
N-[(E)-[6-ethyl-5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-amine (PubChem CID 58877178) has the molecular formula C24H25F4N7O and a molecular weight of 503.50 g/mol. Its IUPAC name is N-[(E)-[6-ethyl-5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-amine.
| Compound Name | N-[(E)-[6-ethyl-5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 58877178 |
| Molecular Formula | C24H25F4N7O |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | N-[(E)-[6-ethyl-5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-amine |
| SMILES | CCc1nc(/C=N/Nc2ncc(F)c(N3CCOCC3C)n2)ccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H25F4N7O/c1-3-20-21(31-17-6-4-5-16(11-17)24(26,27)28)8-7-18(32-20)12-30-34-23-29-13-19(25)22(33-23)35-9-10-36-14-15(35)2/h4-8,11-13,15,31H,3,9-10,14H2,1-2H3,(H,29,33,34)/b30-12+ |
| InChIKey | JYLAKKGCGOYWID-PNQUVVCRSA-N |
| XLogP | 5.01 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|