C24H25F4N7O — CID 90795444
2-ethyl-6-[[[5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-yl]diazenyl]methyl]-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine (PubChem CID 90795444) has the molecular formula C24H25F4N7O and a molecular weight of 503.50 g/mol. Its IUPAC name is 2-ethyl-6-[[[5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-yl]diazenyl]methyl]-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine.
| Compound Name | 2-ethyl-6-[[[5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-yl]diazenyl]methyl]-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 90795444 |
| Molecular Formula | C24H25F4N7O |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 2-ethyl-6-[[[5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-yl]diazenyl]methyl]-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine |
| SMILES | CCc1nc(C/N=N/c2ncc(F)c(N3CCOCC3C)n2)ccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H25F4N7O/c1-3-20-21(31-17-6-4-5-16(11-17)24(26,27)28)8-7-18(32-20)12-30-34-23-29-13-19(25)22(33-23)35-9-10-36-14-15(35)2/h4-8,11,13,15,31H,3,9-10,12,14H2,1-2H3/b34-30+ |
| InChIKey | UNIKSCNTJCLYJC-VBMGMRCRSA-N |
| XLogP | 5.84 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|