C29H21F4N7 — CID 90944429
6-[[[5-fluoro-4-(6-phenyl-2-pyridinyl)pyrimidin-2-yl]diazenyl]methyl]-4-methyl-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine (PubChem CID 90944429) has the molecular formula C29H21F4N7 and a molecular weight of 543.53 g/mol. Its IUPAC name is 6-[[[5-fluoro-4-(6-phenyl-2-pyridinyl)pyrimidin-2-yl]diazenyl]methyl]-4-methyl-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine.
| Compound Name | 6-[[[5-fluoro-4-(6-phenyl-2-pyridinyl)pyrimidin-2-yl]diazenyl]methyl]-4-methyl-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 90944429 |
| Molecular Formula | C29H21F4N7 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 6-[[[5-fluoro-4-(6-phenyl-2-pyridinyl)pyrimidin-2-yl]diazenyl]methyl]-4-methyl-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine |
| SMILES | Cc1cc(C/N=N/c2ncc(F)c(-c3cccc(-c4ccccc4)n3)n2)ncc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H21F4N7/c1-18-13-22(34-17-26(18)37-21-10-5-9-20(14-21)29(31,32)33)15-36-40-28-35-16-23(30)27(39-28)25-12-6-11-24(38-25)19-7-3-2-4-8-19/h2-14,16-17,37H,15H2,1H3/b40-36+ |
| InChIKey | ISLQHOQLNJJWFN-CHJNDSEFSA-N |
| XLogP | 8.09 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|