C24H26F4N8O — CID 143471324
N-amino-N-[(E)-[6-ethyl-5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-amine (PubChem CID 143471324) has the molecular formula C24H26F4N8O and a molecular weight of 518.52 g/mol. Its IUPAC name is N-amino-N-[(E)-[6-ethyl-5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-amine.
| Compound Name | N-amino-N-[(E)-[6-ethyl-5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 143471324 |
| Molecular Formula | C24H26F4N8O |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | N-amino-N-[(E)-[6-ethyl-5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-(3-methylmorpholin-4-yl)pyrimidin-2-amine |
| SMILES | CCc1nc(/C=N/N(N)c2ncc(F)c(N3CCOCC3C)n2)ccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H26F4N8O/c1-3-20-21(32-17-6-4-5-16(11-17)24(26,27)28)8-7-18(33-20)12-31-36(29)23-30-13-19(25)22(34-23)35-9-10-37-14-15(35)2/h4-8,11-13,15,32H,3,9-10,14,29H2,1-2H3/b31-12+ |
| InChIKey | UKRWLFJYRWHDHN-KLPHOBTLSA-N |
| XLogP | 4.27 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|