C22H20F4N6O — CID 143147653
5-fluoro-4-(3-methylmorpholin-4-yl)-N-[(Z)-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methylideneamino]pyrimidin-2-amine (PubChem CID 143147653) has the molecular formula C22H20F4N6O and a molecular weight of 460.44 g/mol. Its IUPAC name is 5-fluoro-4-(3-methylmorpholin-4-yl)-N-[(Z)-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methylideneamino]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-(3-methylmorpholin-4-yl)-N-[(Z)-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143147653 |
| Molecular Formula | C22H20F4N6O |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 5-fluoro-4-(3-methylmorpholin-4-yl)-N-[(Z)-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methylideneamino]pyrimidin-2-amine |
| SMILES | CC1COCCN1c1nc(N/N=C\c2cccc(-c3cccc(C(F)(F)F)c3)n2)ncc1F |
| InChI | InChI=1S/C22H20F4N6O/c1-14-13-33-9-8-32(14)20-18(23)12-27-21(30-20)31-28-11-17-6-3-7-19(29-17)15-4-2-5-16(10-15)22(24,25)26/h2-7,10-12,14H,8-9,13H2,1H3,(H,27,30,31)/b28-11- |
| InChIKey | XTHHMHZQQAZJDM-FXMZOFOKSA-N |
| XLogP | 4.37 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|