C22H18F3N7 — CID 143430854
4-methyl-2-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]quinazoline-2,7-diamine (PubChem CID 143430854) has the molecular formula C22H18F3N7 and a molecular weight of 437.43 g/mol. Its IUPAC name is 4-methyl-2-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]quinazoline-2,7-diamine.
| Compound Name | 4-methyl-2-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]quinazoline-2,7-diamine |
|---|---|
| PubChem CID | 143430854 |
| Molecular Formula | C22H18F3N7 |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-methyl-2-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]quinazoline-2,7-diamine |
| SMILES | Cc1nc(N/N=C/c2ccc(Nc3cccc(C(F)(F)F)c3)cn2)nc2cc(N)ccc12 |
| InChI | InChI=1S/C22H18F3N7/c1-13-19-8-5-15(26)10-20(19)31-21(29-13)32-28-12-17-6-7-18(11-27-17)30-16-4-2-3-14(9-16)22(23,24)25/h2-12,30H,26H2,1H3,(H,29,31,32)/b28-12+ |
| InChIKey | ZTIOGXRMUZYDEC-KVSWJAHQSA-N |
| XLogP | 5.12 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|