C25H28F3N7O — CID 149338581
2-[1-[6-methyl-2-[(2Z)-2-[[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylidene]hydrazinyl]pyrimidin-4-yl]piperidin-4-yl]ethanol (PubChem CID 149338581) has the molecular formula C25H28F3N7O and a molecular weight of 499.54 g/mol. Its IUPAC name is 2-[1-[6-methyl-2-[(2Z)-2-[[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylidene]hydrazinyl]pyrimidin-4-yl]piperidin-4-yl]ethanol.
| Compound Name | 2-[1-[6-methyl-2-[(2Z)-2-[[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylidene]hydrazinyl]pyrimidin-4-yl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 149338581 |
| Molecular Formula | C25H28F3N7O |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 2-[1-[6-methyl-2-[(2Z)-2-[[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylidene]hydrazinyl]pyrimidin-4-yl]piperidin-4-yl]ethanol |
| SMILES | Cc1cc(N2CCC(CCO)CC2)nc(N/N=C\c2ccc(Nc3cccc(C(F)(F)F)c3)cn2)n1 |
| InChI | InChI=1S/C25H28F3N7O/c1-17-13-23(35-10-7-18(8-11-35)9-12-36)33-24(31-17)34-30-16-21-5-6-22(15-29-21)32-20-4-2-3-19(14-20)25(26,27)28/h2-6,13-16,18,32,36H,7-12H2,1H3,(H,31,33,34)/b30-16- |
| InChIKey | YDSMYGVGGWBNNH-UHBFCERESA-N |
| XLogP | 4.99 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|