C30H27F3N6 — CID 143431222
ethane;4-methyl-7-phenyl-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]quinazolin-2-amine (PubChem CID 143431222) has the molecular formula C30H27F3N6 and a molecular weight of 528.58 g/mol. Its IUPAC name is ethane;4-methyl-7-phenyl-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]quinazolin-2-amine.
| Compound Name | ethane;4-methyl-7-phenyl-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]quinazolin-2-amine |
|---|---|
| PubChem CID | 143431222 |
| Molecular Formula | C30H27F3N6 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | ethane;4-methyl-7-phenyl-N-[(E)-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methylideneamino]quinazolin-2-amine |
| SMILES | CC.Cc1nc(N/N=C/c2ccc(Nc3cccc(C(F)(F)F)c3)cn2)nc2cc(-c3ccccc3)ccc12 |
| InChI | InChI=1S/C28H21F3N6.C2H6/c1-18-25-13-10-20(19-6-3-2-4-7-19)14-26(25)36-27(34-18)37-33-17-23-11-12-24(16-32-23)35-22-9-5-8-21(15-22)28(29,30)31;1-2/h2-17,35H,1H3,(H,34,36,37);1-2H3/b33-17+; |
| InChIKey | LIBHKGPSZCQJBG-KYEJVWEESA-N |
| XLogP | 8.23 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|