C26H20F3N5O2S2 — CID 90014660
4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-[[3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 90014660) has the molecular formula C26H20F3N5O2S2 and a molecular weight of 555.61 g/mol. Its IUPAC name is 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-[[3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-[[3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 90014660 |
| Molecular Formula | C26H20F3N5O2S2 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-[[3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)C1CCc2c(sc3ncnc(Nc4ccc5[nH]c(=O)sc5c4)c23)C1 |
| InChI | InChI=1S/C26H20F3N5O2S2/c27-26(28,29)15-3-1-2-13(8-15)11-30-23(35)14-4-6-17-19(9-14)37-24-21(17)22(31-12-32-24)33-16-5-7-18-20(10-16)38-25(36)34-18/h1-3,5,7-8,10,12,14H,4,6,9,11H2,(H,30,35)(H,34,36)(H,31,32,33) |
| InChIKey | MTIGOIUHEFMHTK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |