C25H24N6O2S2 — CID 163560565
N-[(benzylamino)methyl]-4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-amine oxide (PubChem CID 163560565) has the molecular formula C25H24N6O2S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is N-[(benzylamino)methyl]-4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-amine oxide.
| Compound Name | N-[(benzylamino)methyl]-4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-amine oxide |
|---|---|
| PubChem CID | 163560565 |
| Molecular Formula | C25H24N6O2S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N-[(benzylamino)methyl]-4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-amine oxide |
| SMILES | O=c1[nH]c2ccc(Nc3ncnc4sc5c(c34)CCC([NH+]([O-])CNCc3ccccc3)C5)cc2s1 |
| InChI | InChI=1S/C25H24N6O2S2/c32-25-30-19-9-6-16(10-21(19)35-25)29-23-22-18-8-7-17(11-20(18)34-24(22)28-13-27-23)31(33)14-26-12-15-4-2-1-3-5-15/h1-6,9-10,13,17,26,31H,7-8,11-12,14H2,(H,30,32)(H,27,28,29) |
| InChIKey | FQWIOGZKCMUTEH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|