C18H18N6OS2 — CID 123550445
6-[[7-(aminomethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one (PubChem CID 123550445) has the molecular formula C18H18N6OS2 and a molecular weight of 398.52 g/mol. Its IUPAC name is 6-[[7-(aminomethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-[[7-(aminomethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 123550445 |
| Molecular Formula | C18H18N6OS2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 6-[[7-(aminomethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one |
| SMILES | NCNC1CCc2c(sc3ncnc(Nc4ccc5[nH]c(=O)sc5c4)c23)C1 |
| InChI | InChI=1S/C18H18N6OS2/c19-7-20-9-1-3-11-13(5-9)26-17-15(11)16(21-8-22-17)23-10-2-4-12-14(6-10)27-18(25)24-12/h2,4,6,8-9,20H,1,3,5,7,19H2,(H,24,25)(H,21,22,23) |
| InChIKey | ZPSNNHOTJKEHNI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|