C12H10F3N3O2 — CID 134101628
6-[[3-(trifluoromethyl)anilino]methyl]-1H-pyrimidine-2,4-dione (PubChem CID 134101628) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.23 g/mol. Its IUPAC name is 6-[[3-(trifluoromethyl)anilino]methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[[3-(trifluoromethyl)anilino]methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134101628 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 6-[[3-(trifluoromethyl)anilino]methyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(CNc2cccc(C(F)(F)F)c2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C12H10F3N3O2/c13-12(14,15)7-2-1-3-8(4-7)16-6-9-5-10(19)18-11(20)17-9/h1-5,16H,6H2,(H2,17,18,19,20) |
| InChIKey | ZZJKSQNWZXKLDQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |