C17H13BrFN3O3 — CID 155951030
6-[[3-bromo-4-(3-fluorophenoxy)anilino]methyl]-1H-pyrimidine-2,4-dione (PubChem CID 155951030) has the molecular formula C17H13BrFN3O3 and a molecular weight of 406.21 g/mol. Its IUPAC name is 6-[[3-bromo-4-(3-fluorophenoxy)anilino]methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[[3-bromo-4-(3-fluorophenoxy)anilino]methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155951030 |
| Molecular Formula | C17H13BrFN3O3 |
| Molecular Weight | 406.21 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 6-[[3-bromo-4-(3-fluorophenoxy)anilino]methyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(CNc2ccc(Oc3cccc(F)c3)c(Br)c2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C17H13BrFN3O3/c18-14-7-11(20-9-12-8-16(23)22-17(24)21-12)4-5-15(14)25-13-3-1-2-10(19)6-13/h1-8,20H,9H2,(H2,21,22,23,24) |
| InChIKey | FLWHJLGZRJRIMD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |