C10H4F6N2O3 — CID 19990430
4-hydroxy-5,7-bis(trifluoromethyl)-1H-quinoxaline-2,3-dione (PubChem CID 19990430) has the molecular formula C10H4F6N2O3 and a molecular weight of 314.14 g/mol. Its IUPAC name is 4-hydroxy-5,7-bis(trifluoromethyl)-1H-quinoxaline-2,3-dione.
| Compound Name | 4-hydroxy-5,7-bis(trifluoromethyl)-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 19990430 |
| Molecular Formula | C10H4F6N2O3 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 4-hydroxy-5,7-bis(trifluoromethyl)-1H-quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc(C(F)(F)F)cc(C(F)(F)F)c2n(O)c1=O |
| InChI | InChI=1S/C10H4F6N2O3/c11-9(12,13)3-1-4(10(14,15)16)6-5(2-3)17-7(19)8(20)18(6)21/h1-2,21H,(H,17,19) |
| InChIKey | JORONMAUWOHCBV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|