C9H6ClF3N2O — CID 5324659
4-chloro-3-methyl-6-(trifluoromethyl)-1H-benzimidazol-2-one (PubChem CID 5324659) has the molecular formula C9H6ClF3N2O and a molecular weight of 250.61 g/mol. Its IUPAC name is 4-chloro-3-methyl-6-(trifluoromethyl)-1H-benzimidazol-2-one.
| Compound Name | 4-chloro-3-methyl-6-(trifluoromethyl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 5324659 |
| Molecular Formula | C9H6ClF3N2O |
| Molecular Weight | 250.61 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 4-chloro-3-methyl-6-(trifluoromethyl)-1H-benzimidazol-2-one |
| SMILES | Cn1c(=O)[nH]c2cc(C(F)(F)F)cc(Cl)c21 |
| InChI | InChI=1S/C9H6ClF3N2O/c1-15-7-5(10)2-4(9(11,12)13)3-6(7)14-8(15)16/h2-3H,1H3,(H,14,16) |
| InChIKey | KSSDEFFKKHZKDB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |