C18H16F3N2O5P — CID 142635809
[2,3-dioxo-7-(1-phenylethyl)-6-(trifluoromethyl)-4H-quinoxalin-1-yl]methylphosphonic acid (PubChem CID 142635809) has the molecular formula C18H16F3N2O5P and a molecular weight of 428.30 g/mol. Its IUPAC name is [2,3-dioxo-7-(1-phenylethyl)-6-(trifluoromethyl)-4H-quinoxalin-1-yl]methylphosphonic acid.
| Compound Name | [2,3-dioxo-7-(1-phenylethyl)-6-(trifluoromethyl)-4H-quinoxalin-1-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 142635809 |
| Molecular Formula | C18H16F3N2O5P |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | [2,3-dioxo-7-(1-phenylethyl)-6-(trifluoromethyl)-4H-quinoxalin-1-yl]methylphosphonic acid |
| SMILES | CC(c1ccccc1)c1cc2c(cc1C(F)(F)F)[nH]c(=O)c(=O)n2CP(=O)(O)O |
| InChI | InChI=1S/C18H16F3N2O5P/c1-10(11-5-3-2-4-6-11)12-7-15-14(8-13(12)18(19,20)21)22-16(24)17(25)23(15)9-29(26,27)28/h2-8,10H,9H2,1H3,(H,22,24)(H2,26,27,28) |
| InChIKey | YLPBDZBSDFOREH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|