C16H11F3N4O3 — CID 15337736
N-[7-amino-2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]benzamide (PubChem CID 15337736) has the molecular formula C16H11F3N4O3 and a molecular weight of 364.28 g/mol. Its IUPAC name is N-[7-amino-2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]benzamide.
| Compound Name | N-[7-amino-2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]benzamide |
|---|---|
| PubChem CID | 15337736 |
| Molecular Formula | C16H11F3N4O3 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-[7-amino-2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]benzamide |
| SMILES | Nc1cc2c(cc1C(F)(F)F)[nH]c(=O)c(=O)n2NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H11F3N4O3/c17-16(18,19)9-6-11-12(7-10(9)20)23(15(26)14(25)21-11)22-13(24)8-4-2-1-3-5-8/h1-7H,20H2,(H,21,25)(H,22,24) |
| InChIKey | INMFFOZIZZKQOT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|