C24H6F18 — CID 90327361
1,3,6,8,10,11-hexakis(trifluoromethyl)triphenylene (PubChem CID 90327361) has the molecular formula C24H6F18 and a molecular weight of 636.28 g/mol. Its IUPAC name is 1,3,6,8,10,11-hexakis(trifluoromethyl)triphenylene.
| Compound Name | 1,3,6,8,10,11-hexakis(trifluoromethyl)triphenylene |
|---|---|
| PubChem CID | 90327361 |
| Molecular Formula | C24H6F18 |
| Molecular Weight | 636.28 g/mol |
| Exact Mass | 636.02 |
| IUPAC Name | 1,3,6,8,10,11-hexakis(trifluoromethyl)triphenylene |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c2c(c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1c1cc(C(F)(F)F)c(C(F)(F)F)cc12 |
| InChI | InChI=1S/C24H6F18/c25-19(26,27)7-1-9-10-2-8(20(28,29)30)4-16(24(40,41)42)18(10)12-6-14(22(34,35)36)13(21(31,32)33)5-11(12)17(9)15(3-7)23(37,38)39/h1-6H |
| InChIKey | NDPTVVPGYYZXOH-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.28 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|